C7H12F3N — CID 25323749
cis-(1R,2S)-2-(trifluoromethyl)cyclohexan-1-amine (PubChem CID 25323749) has the molecular formula C7H12F3N and a molecular weight of 167.17 g/mol. Its IUPAC name is cis-(1R,2S)-2-(trifluoromethyl)cyclohexan-1-amine.
| Compound Name | cis-(1R,2S)-2-(trifluoromethyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 25323749 |
| Molecular Formula | C7H12F3N |
| Molecular Weight | 167.17 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | cis-(1R,2S)-2-(trifluoromethyl)cyclohexan-1-amine |
| SMILES | N[C@@H]1CCCC[C@@H]1C(F)(F)F |
| InChI | InChI=1S/C7H12F3N/c8-7(9,10)5-3-1-2-4-6(5)11/h5-6H,1-4,11H2/t5-,6+/m0/s1 |
| InChIKey | KHKJUJGNSSJMED-NTSWFWBYSA-N |
| XLogP | 2.07 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.17 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |