C22H32N4O3S — CID 25328524
N-[3-[(2S)-2-methylpiperidin-1-yl]propyl]-5,5-dioxo-8,9,10,11-tetrahydro-7H-azepino[2,1-c][1,2,4]benzothiadiazine-3-carboxamide (PubChem CID 25328524) has the molecular formula C22H32N4O3S and a molecular weight of 432.59 g/mol. Its IUPAC name is N-[3-[(2S)-2-methylpiperidin-1-yl]propyl]-5,5-dioxo-8,9,10,11-tetrahydro-7H-azepino[2,1-c][1,2,4]benzothiadiazine-3-carboxamide.
| Compound Name | N-[3-[(2S)-2-methylpiperidin-1-yl]propyl]-5,5-dioxo-8,9,10,11-tetrahydro-7H-azepino[2,1-c][1,2,4]benzothiadiazine-3-carboxamide |
|---|---|
| PubChem CID | 25328524 |
| Molecular Formula | C22H32N4O3S |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | N-[3-[(2S)-2-methylpiperidin-1-yl]propyl]-5,5-dioxo-8,9,10,11-tetrahydro-7H-azepino[2,1-c][1,2,4]benzothiadiazine-3-carboxamide |
| SMILES | C[C@H]1CCCCN1CCCNC(=O)c1ccc2c(c1)S(=O)(=O)N=C1CCCCCN12 |
| InChI | InChI=1S/C22H32N4O3S/c1-17-8-4-6-13-25(17)14-7-12-23-22(27)18-10-11-19-20(16-18)30(28,29)24-21-9-3-2-5-15-26(19)21/h10-11,16-17H,2-9,12-15H2,1H3,(H,23,27)/t17-/m0/s1 |
| InChIKey | SZNAUUJLMQSIPN-KRWDZBQOSA-N |
| XLogP | 3.16 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|