C21H23N5O4S2 — CID 25330286
2-[4,5-dimethyl-1-[[(2S)-oxolan-2-yl]methyl]imidazol-2-yl]sulfanyl-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 25330286) has the molecular formula C21H23N5O4S2 and a molecular weight of 473.58 g/mol. Its IUPAC name is 2-[4,5-dimethyl-1-[[(2S)-oxolan-2-yl]methyl]imidazol-2-yl]sulfanyl-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-[4,5-dimethyl-1-[[(2S)-oxolan-2-yl]methyl]imidazol-2-yl]sulfanyl-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 25330286 |
| Molecular Formula | C21H23N5O4S2 |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | 2-[4,5-dimethyl-1-[[(2S)-oxolan-2-yl]methyl]imidazol-2-yl]sulfanyl-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | Cc1nc(SCC(=O)Nc2nc(-c3cccc([N+](=O)[O-])c3)cs2)n(C[C@@H]2CCCO2)c1C |
| InChI | InChI=1S/C21H23N5O4S2/c1-13-14(2)25(10-17-7-4-8-30-17)21(22-13)32-12-19(27)24-20-23-18(11-31-20)15-5-3-6-16(9-15)26(28)29/h3,5-6,9,11,17H,4,7-8,10,12H2,1-2H3,(H,23,24,27)/t17-/m0/s1 |
| InChIKey | VKDSWHFRHHETOF-KRWDZBQOSA-N |
| XLogP | 4.44 |
| TPSA | 112.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|