C24H28N4O4S — CID 25331651
4-[[5-[(4-butylphenyl)sulfamoyl]-2-methylbenzoyl]amino]-1-methylpyrrole-2-carboxamide (PubChem CID 25331651) has the molecular formula C24H28N4O4S and a molecular weight of 468.58 g/mol. Its IUPAC name is 4-[[5-[(4-butylphenyl)sulfamoyl]-2-methylbenzoyl]amino]-1-methylpyrrole-2-carboxamide.
| Compound Name | 4-[[5-[(4-butylphenyl)sulfamoyl]-2-methylbenzoyl]amino]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 25331651 |
| Molecular Formula | C24H28N4O4S |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | 4-[[5-[(4-butylphenyl)sulfamoyl]-2-methylbenzoyl]amino]-1-methylpyrrole-2-carboxamide |
| SMILES | CCCCc1ccc(NS(=O)(=O)c2ccc(C)c(C(=O)Nc3cc(C(N)=O)n(C)c3)c2)cc1 |
| InChI | InChI=1S/C24H28N4O4S/c1-4-5-6-17-8-10-18(11-9-17)27-33(31,32)20-12-7-16(2)21(14-20)24(30)26-19-13-22(23(25)29)28(3)15-19/h7-15,27H,4-6H2,1-3H3,(H2,25,29)(H,26,30) |
| InChIKey | FENOHDHVQYWTKC-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 123.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |