C21H22ClN3O3 — CID 2533606
(E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methylprop-2-enamide (PubChem CID 2533606) has the molecular formula C21H22ClN3O3 and a molecular weight of 399.88 g/mol. Its IUPAC name is (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methylprop-2-enamide.
| Compound Name | (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 2533606 |
| Molecular Formula | C21H22ClN3O3 |
| Molecular Weight | 399.88 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methylprop-2-enamide |
| SMILES | COc1ccc(CCN(C)C(=O)/C=C/c2c(Cl)nc3ccccn23)cc1OC |
| InChI | InChI=1S/C21H22ClN3O3/c1-24(13-11-15-7-9-17(27-2)18(14-15)28-3)20(26)10-8-16-21(22)23-19-6-4-5-12-25(16)19/h4-10,12,14H,11,13H2,1-3H3/b10-8+ |
| InChIKey | IGRWVMALLCAXOK-CSKARUKUSA-N |
| XLogP | 3.72 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.88 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|