C29H28N2O6 — CID 25340239
[(2S)-1-(4-morpholin-4-ylanilino)-1-oxopropan-2-yl] 3-(phenoxymethyl)-1-benzofuran-2-carboxylate (PubChem CID 25340239) has the molecular formula C29H28N2O6 and a molecular weight of 500.55 g/mol. Its IUPAC name is [(2S)-1-(4-morpholin-4-ylanilino)-1-oxopropan-2-yl] 3-(phenoxymethyl)-1-benzofuran-2-carboxylate.
| Compound Name | [(2S)-1-(4-morpholin-4-ylanilino)-1-oxopropan-2-yl] 3-(phenoxymethyl)-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 25340239 |
| Molecular Formula | C29H28N2O6 |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.19 |
| IUPAC Name | [(2S)-1-(4-morpholin-4-ylanilino)-1-oxopropan-2-yl] 3-(phenoxymethyl)-1-benzofuran-2-carboxylate |
| SMILES | C[C@H](OC(=O)c1oc2ccccc2c1COc1ccccc1)C(=O)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C29H28N2O6/c1-20(28(32)30-21-11-13-22(14-12-21)31-15-17-34-18-16-31)36-29(33)27-25(19-35-23-7-3-2-4-8-23)24-9-5-6-10-26(24)37-27/h2-14,20H,15-19H2,1H3,(H,30,32)/t20-/m0/s1 |
| InChIKey | GYIJEINNQPNYGJ-FQEVSTJZSA-N |
| XLogP | 5.03 |
| TPSA | 90.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|