C19H18N4O3S — CID 25341438
3-cyano-N-[(R)-(2-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]benzenesulfonamide (PubChem CID 25341438) has the molecular formula C19H18N4O3S and a molecular weight of 382.45 g/mol. Its IUPAC name is 3-cyano-N-[(R)-(2-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]benzenesulfonamide.
| Compound Name | 3-cyano-N-[(R)-(2-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 25341438 |
| Molecular Formula | C19H18N4O3S |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 3-cyano-N-[(R)-(2-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]benzenesulfonamide |
| SMILES | COc1ccccc1[C@@H](NS(=O)(=O)c1cccc(C#N)c1)c1nccn1C |
| InChI | InChI=1S/C19H18N4O3S/c1-23-11-10-21-19(23)18(16-8-3-4-9-17(16)26-2)22-27(24,25)15-7-5-6-14(12-15)13-20/h3-12,18,22H,1-2H3/t18-/m1/s1 |
| InChIKey | MWYZHVBLTDSCHV-GOSISDBHSA-N |
| XLogP | 2.37 |
| TPSA | 97.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |