C18H17N5O — CID 41015325
6-[[(S)-(2-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]amino]pyridine-3-carbonitrile (PubChem CID 41015325) has the molecular formula C18H17N5O and a molecular weight of 319.37 g/mol. Its IUPAC name is 6-[[(S)-(2-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]amino]pyridine-3-carbonitrile.
| Compound Name | 6-[[(S)-(2-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]amino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 41015325 |
| Molecular Formula | C18H17N5O |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 6-[[(S)-(2-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]amino]pyridine-3-carbonitrile |
| SMILES | COc1ccccc1[C@H](Nc1ccc(C#N)cn1)c1nccn1C |
| InChI | InChI=1S/C18H17N5O/c1-23-10-9-20-18(23)17(14-5-3-4-6-15(14)24-2)22-16-8-7-13(11-19)12-21-16/h3-10,12,17H,1-2H3,(H,21,22)/t17-/m0/s1 |
| InChIKey | OROCMCBFCRAMQN-KRWDZBQOSA-N |
| XLogP | 2.90 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |