C22H25N5O2S — CID 25341486
2-[4-[2-(1H-benzimidazol-2-ylsulfanyl)acetyl]piperazin-1-yl]-N-(4-methylphenyl)acetamide (PubChem CID 25341486) has the molecular formula C22H25N5O2S and a molecular weight of 423.54 g/mol. Its IUPAC name is 2-[4-[2-(1H-benzimidazol-2-ylsulfanyl)acetyl]piperazin-1-yl]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[4-[2-(1H-benzimidazol-2-ylsulfanyl)acetyl]piperazin-1-yl]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 25341486 |
| Molecular Formula | C22H25N5O2S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | 2-[4-[2-(1H-benzimidazol-2-ylsulfanyl)acetyl]piperazin-1-yl]-N-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)CN2CCN(C(=O)CSc3nc4ccccc4[nH]3)CC2)cc1 |
| InChI | InChI=1S/C22H25N5O2S/c1-16-6-8-17(9-7-16)23-20(28)14-26-10-12-27(13-11-26)21(29)15-30-22-24-18-4-2-3-5-19(18)25-22/h2-9H,10-15H2,1H3,(H,23,28)(H,24,25) |
| InChIKey | BJURWGYGEVAAAT-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 81.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |