C19H24IN3O2S — CID 25341684
2-[4,5-dimethyl-1-[[(2S)-oxolan-2-yl]methyl]imidazol-2-yl]sulfanyl-N-(4-iodo-2-methylphenyl)acetamide (PubChem CID 25341684) has the molecular formula C19H24IN3O2S and a molecular weight of 485.39 g/mol. Its IUPAC name is 2-[4,5-dimethyl-1-[[(2S)-oxolan-2-yl]methyl]imidazol-2-yl]sulfanyl-N-(4-iodo-2-methylphenyl)acetamide.
| Compound Name | 2-[4,5-dimethyl-1-[[(2S)-oxolan-2-yl]methyl]imidazol-2-yl]sulfanyl-N-(4-iodo-2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 25341684 |
| Molecular Formula | C19H24IN3O2S |
| Molecular Weight | 485.39 g/mol |
| Exact Mass | 485.06 |
| IUPAC Name | 2-[4,5-dimethyl-1-[[(2S)-oxolan-2-yl]methyl]imidazol-2-yl]sulfanyl-N-(4-iodo-2-methylphenyl)acetamide |
| SMILES | Cc1cc(I)ccc1NC(=O)CSc1nc(C)c(C)n1C[C@@H]1CCCO1 |
| InChI | InChI=1S/C19H24IN3O2S/c1-12-9-15(20)6-7-17(12)22-18(24)11-26-19-21-13(2)14(3)23(19)10-16-5-4-8-25-16/h6-7,9,16H,4-5,8,10-11H2,1-3H3,(H,22,24)/t16-/m0/s1 |
| InChIKey | KUJQGJCWTSOTRM-INIZCTEOSA-N |
| XLogP | 4.32 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.39 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|