C20H23F3N4O3S — CID 42918651
2-[[2-[4,5-dimethyl-1-(oxolan-2-ylmethyl)imidazol-2-yl]sulfanylacetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 42918651) has the molecular formula C20H23F3N4O3S and a molecular weight of 456.49 g/mol. Its IUPAC name is 2-[[2-[4,5-dimethyl-1-(oxolan-2-ylmethyl)imidazol-2-yl]sulfanylacetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[[2-[4,5-dimethyl-1-(oxolan-2-ylmethyl)imidazol-2-yl]sulfanylacetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 42918651 |
| Molecular Formula | C20H23F3N4O3S |
| Molecular Weight | 456.49 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | 2-[[2-[4,5-dimethyl-1-(oxolan-2-ylmethyl)imidazol-2-yl]sulfanylacetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | Cc1nc(SCC(=O)NCC(=O)Nc2ccc(F)c(F)c2F)n(CC2CCCO2)c1C |
| InChI | InChI=1S/C20H23F3N4O3S/c1-11-12(2)27(9-13-4-3-7-30-13)20(25-11)31-10-17(29)24-8-16(28)26-15-6-5-14(21)18(22)19(15)23/h5-6,13H,3-4,7-10H2,1-2H3,(H,24,29)(H,26,28) |
| InChIKey | GKHGBXJARCOWBX-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.49 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|