C15H13N5O3S — CID 25344012
4-methylsulfonyl-N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]benzamide (PubChem CID 25344012) has the molecular formula C15H13N5O3S and a molecular weight of 343.37 g/mol. Its IUPAC name is 4-methylsulfonyl-N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]benzamide.
| Compound Name | 4-methylsulfonyl-N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]benzamide |
|---|---|
| PubChem CID | 25344012 |
| Molecular Formula | C15H13N5O3S |
| Molecular Weight | 343.37 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | 4-methylsulfonyl-N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]benzamide |
| SMILES | CS(=O)(=O)c1ccc(C(=O)Nc2ccc(-n3cncn3)nc2)cc1 |
| InChI | InChI=1S/C15H13N5O3S/c1-24(22,23)13-5-2-11(3-6-13)15(21)19-12-4-7-14(17-8-12)20-10-16-9-18-20/h2-10H,1H3,(H,19,21) |
| InChIKey | JNGBPJLQABLJAK-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 106.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.37 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |