C24H23N3O — CID 25345296
(4S)-1-ethyl-4-[1-(naphthalen-1-ylmethyl)benzimidazol-2-yl]pyrrolidin-2-one (PubChem CID 25345296) has the molecular formula C24H23N3O and a molecular weight of 369.47 g/mol. Its IUPAC name is (4S)-1-ethyl-4-[1-(naphthalen-1-ylmethyl)benzimidazol-2-yl]pyrrolidin-2-one.
| Compound Name | (4S)-1-ethyl-4-[1-(naphthalen-1-ylmethyl)benzimidazol-2-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 25345296 |
| Molecular Formula | C24H23N3O |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | (4S)-1-ethyl-4-[1-(naphthalen-1-ylmethyl)benzimidazol-2-yl]pyrrolidin-2-one |
| SMILES | CCN1C[C@@H](c2nc3ccccc3n2Cc2cccc3ccccc23)CC1=O |
| InChI | InChI=1S/C24H23N3O/c1-2-26-15-19(14-23(26)28)24-25-21-12-5-6-13-22(21)27(24)16-18-10-7-9-17-8-3-4-11-20(17)18/h3-13,19H,2,14-16H2,1H3/t19-/m0/s1 |
| InChIKey | CUGPEMPLKCLLIC-IBGZPJMESA-N |
| XLogP | 4.57 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |