C19H23N3O3S — CID 25347165
(6R)-N'-[2-(4-methoxyanilino)acetyl]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbohydrazide (PubChem CID 25347165) has the molecular formula C19H23N3O3S and a molecular weight of 373.48 g/mol. Its IUPAC name is (6R)-N'-[2-(4-methoxyanilino)acetyl]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbohydrazide.
| Compound Name | (6R)-N'-[2-(4-methoxyanilino)acetyl]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbohydrazide |
|---|---|
| PubChem CID | 25347165 |
| Molecular Formula | C19H23N3O3S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | (6R)-N'-[2-(4-methoxyanilino)acetyl]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbohydrazide |
| SMILES | COc1ccc(NCC(=O)NNC(=O)c2csc3c2CC[C@@H](C)C3)cc1 |
| InChI | InChI=1S/C19H23N3O3S/c1-12-3-8-15-16(11-26-17(15)9-12)19(24)22-21-18(23)10-20-13-4-6-14(25-2)7-5-13/h4-7,11-12,20H,3,8-10H2,1-2H3,(H,21,23)(H,22,24)/t12-/m1/s1 |
| InChIKey | IYRJREIPBCSFEI-GFCCVEGCSA-N |
| XLogP | 2.75 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|