C18H18BrN3O4S — CID 25349583
N-(3-bromo-4-methylphenyl)-5-morpholin-4-ylsulfonyl-1,3-benzoxazol-2-amine (PubChem CID 25349583) has the molecular formula C18H18BrN3O4S and a molecular weight of 452.33 g/mol. Its IUPAC name is N-(3-bromo-4-methylphenyl)-5-morpholin-4-ylsulfonyl-1,3-benzoxazol-2-amine.
| Compound Name | N-(3-bromo-4-methylphenyl)-5-morpholin-4-ylsulfonyl-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 25349583 |
| Molecular Formula | C18H18BrN3O4S |
| Molecular Weight | 452.33 g/mol |
| Exact Mass | 451.02 |
| IUPAC Name | N-(3-bromo-4-methylphenyl)-5-morpholin-4-ylsulfonyl-1,3-benzoxazol-2-amine |
| SMILES | Cc1ccc(Nc2nc3cc(S(=O)(=O)N4CCOCC4)ccc3o2)cc1Br |
| InChI | InChI=1S/C18H18BrN3O4S/c1-12-2-3-13(10-15(12)19)20-18-21-16-11-14(4-5-17(16)26-18)27(23,24)22-6-8-25-9-7-22/h2-5,10-11H,6-9H2,1H3,(H,20,21) |
| InChIKey | MKLBHRNQPNZZSW-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.33 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |