C24H27N3O5 — CID 25354760
[(2S)-5-oxopyrrolidin-2-yl]methyl 2-(4-benzylpiperidin-1-yl)-5-nitrobenzoate (PubChem CID 25354760) has the molecular formula C24H27N3O5 and a molecular weight of 437.50 g/mol. Its IUPAC name is [(2S)-5-oxopyrrolidin-2-yl]methyl 2-(4-benzylpiperidin-1-yl)-5-nitrobenzoate.
| Compound Name | [(2S)-5-oxopyrrolidin-2-yl]methyl 2-(4-benzylpiperidin-1-yl)-5-nitrobenzoate |
|---|---|
| PubChem CID | 25354760 |
| Molecular Formula | C24H27N3O5 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | [(2S)-5-oxopyrrolidin-2-yl]methyl 2-(4-benzylpiperidin-1-yl)-5-nitrobenzoate |
| SMILES | O=C1CC[C@@H](COC(=O)c2cc([N+](=O)[O-])ccc2N2CCC(Cc3ccccc3)CC2)N1 |
| InChI | InChI=1S/C24H27N3O5/c28-23-9-6-19(25-23)16-32-24(29)21-15-20(27(30)31)7-8-22(21)26-12-10-18(11-13-26)14-17-4-2-1-3-5-17/h1-5,7-8,15,18-19H,6,9-14,16H2,(H,25,28)/t19-/m0/s1 |
| InChIKey | SOPMWPRMHFPZLL-IBGZPJMESA-N |
| XLogP | 3.49 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|