C21H18ClN3O6S — CID 25354987
methyl (6S)-6-(2-chloro-5-nitrophenyl)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-methyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate (PubChem CID 25354987) has the molecular formula C21H18ClN3O6S and a molecular weight of 475.91 g/mol. Its IUPAC name is methyl (6S)-6-(2-chloro-5-nitrophenyl)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-methyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate.
| Compound Name | methyl (6S)-6-(2-chloro-5-nitrophenyl)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-methyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 25354987 |
| Molecular Formula | C21H18ClN3O6S |
| Molecular Weight | 475.91 g/mol |
| Exact Mass | 475.06 |
| IUPAC Name | methyl (6S)-6-(2-chloro-5-nitrophenyl)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-methyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate |
| SMILES | COC(=O)C1=C(C)N(c2ccc3c(c2)OCCO3)C(=S)N[C@@H]1c1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C21H18ClN3O6S/c1-11-18(20(26)29-2)19(14-9-13(25(27)28)3-5-15(14)22)23-21(32)24(11)12-4-6-16-17(10-12)31-8-7-30-16/h3-6,9-10,19H,7-8H2,1-2H3,(H,23,32)/t19-/m1/s1 |
| InChIKey | ZMGZZIRSEFXEFS-LJQANCHMSA-N |
| XLogP | 3.90 |
| TPSA | 103.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.91 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|