C22H21ClN4O5S — CID 35883982
(6S)-6-(4-chloro-3-nitrophenyl)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-N,N,4-trimethyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxamide (PubChem CID 35883982) has the molecular formula C22H21ClN4O5S and a molecular weight of 488.95 g/mol. Its IUPAC name is (6S)-6-(4-chloro-3-nitrophenyl)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-N,N,4-trimethyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxamide.
| Compound Name | (6S)-6-(4-chloro-3-nitrophenyl)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-N,N,4-trimethyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 35883982 |
| Molecular Formula | C22H21ClN4O5S |
| Molecular Weight | 488.95 g/mol |
| Exact Mass | 488.09 |
| IUPAC Name | (6S)-6-(4-chloro-3-nitrophenyl)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-N,N,4-trimethyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxamide |
| SMILES | CC1=C(C(=O)N(C)C)[C@H](c2ccc(Cl)c([N+](=O)[O-])c2)NC(=S)N1c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C22H21ClN4O5S/c1-12-19(21(28)25(2)3)20(13-4-6-15(23)16(10-13)27(29)30)24-22(33)26(12)14-5-7-17-18(11-14)32-9-8-31-17/h4-7,10-11,20H,8-9H2,1-3H3,(H,24,33)/t20-/m0/s1 |
| InChIKey | ARTIRNSBEAYKDF-FQEVSTJZSA-N |
| XLogP | 3.82 |
| TPSA | 97.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.95 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|