C23H23ClN4O4S — CID 46802476
[6-(4-chloro-3-nitrophenyl)-4-methyl-3-(3-methylphenyl)-2-sulfanylidene-1,6-dihydropyrimidin-5-yl]-morpholin-4-ylmethanone (PubChem CID 46802476) has the molecular formula C23H23ClN4O4S and a molecular weight of 486.98 g/mol. Its IUPAC name is [6-(4-chloro-3-nitrophenyl)-4-methyl-3-(3-methylphenyl)-2-sulfanylidene-1,6-dihydropyrimidin-5-yl]-morpholin-4-ylmethanone.
| Compound Name | [6-(4-chloro-3-nitrophenyl)-4-methyl-3-(3-methylphenyl)-2-sulfanylidene-1,6-dihydropyrimidin-5-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 46802476 |
| Molecular Formula | C23H23ClN4O4S |
| Molecular Weight | 486.98 g/mol |
| Exact Mass | 486.11 |
| IUPAC Name | [6-(4-chloro-3-nitrophenyl)-4-methyl-3-(3-methylphenyl)-2-sulfanylidene-1,6-dihydropyrimidin-5-yl]-morpholin-4-ylmethanone |
| SMILES | CC1=C(C(=O)N2CCOCC2)C(c2ccc(Cl)c([N+](=O)[O-])c2)NC(=S)N1c1cccc(C)c1 |
| InChI | InChI=1S/C23H23ClN4O4S/c1-14-4-3-5-17(12-14)27-15(2)20(22(29)26-8-10-32-11-9-26)21(25-23(27)33)16-6-7-18(24)19(13-16)28(30)31/h3-7,12-13,21H,8-11H2,1-2H3,(H,25,33) |
| InChIKey | CZFCKHWMCGKBDC-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.98 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|