C22H22ClN3O2S — CID 42992764
[6-(3-chlorophenyl)-4-methyl-3-phenyl-2-sulfanylidene-1,6-dihydropyrimidin-5-yl]-morpholin-4-ylmethanone (PubChem CID 42992764) has the molecular formula C22H22ClN3O2S and a molecular weight of 427.96 g/mol. Its IUPAC name is [6-(3-chlorophenyl)-4-methyl-3-phenyl-2-sulfanylidene-1,6-dihydropyrimidin-5-yl]-morpholin-4-ylmethanone.
| Compound Name | [6-(3-chlorophenyl)-4-methyl-3-phenyl-2-sulfanylidene-1,6-dihydropyrimidin-5-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 42992764 |
| Molecular Formula | C22H22ClN3O2S |
| Molecular Weight | 427.96 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | [6-(3-chlorophenyl)-4-methyl-3-phenyl-2-sulfanylidene-1,6-dihydropyrimidin-5-yl]-morpholin-4-ylmethanone |
| SMILES | CC1=C(C(=O)N2CCOCC2)C(c2cccc(Cl)c2)NC(=S)N1c1ccccc1 |
| InChI | InChI=1S/C22H22ClN3O2S/c1-15-19(21(27)25-10-12-28-13-11-25)20(16-6-5-7-17(23)14-16)24-22(29)26(15)18-8-3-2-4-9-18/h2-9,14,20H,10-13H2,1H3,(H,24,29) |
| InChIKey | KLUZFXLCIGGZTI-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.96 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|