C22H20N4O2S — CID 25414809
(6R)-4-methyl-N-(5-methyl-1,2-oxazol-3-yl)-3,6-diphenyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxamide (PubChem CID 25414809) has the molecular formula C22H20N4O2S and a molecular weight of 404.50 g/mol. Its IUPAC name is (6R)-4-methyl-N-(5-methyl-1,2-oxazol-3-yl)-3,6-diphenyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxamide.
| Compound Name | (6R)-4-methyl-N-(5-methyl-1,2-oxazol-3-yl)-3,6-diphenyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 25414809 |
| Molecular Formula | C22H20N4O2S |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | (6R)-4-methyl-N-(5-methyl-1,2-oxazol-3-yl)-3,6-diphenyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxamide |
| SMILES | CC1=C(C(=O)Nc2cc(C)on2)[C@@H](c2ccccc2)NC(=S)N1c1ccccc1 |
| InChI | InChI=1S/C22H20N4O2S/c1-14-13-18(25-28-14)23-21(27)19-15(2)26(17-11-7-4-8-12-17)22(29)24-20(19)16-9-5-3-6-10-16/h3-13,20H,1-2H3,(H,24,29)(H,23,25,27)/t20-/m1/s1 |
| InChIKey | MRFGHGQDULBOKH-HXUWFJFHSA-N |
| XLogP | 4.33 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|