C26H24N4O3S — CID 42935272
4-methyl-N-(5-methyl-1,2-oxazol-3-yl)-3-(3-methylphenyl)-6-(2-prop-2-ynoxyphenyl)-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxamide (PubChem CID 42935272) has the molecular formula C26H24N4O3S and a molecular weight of 472.57 g/mol. Its IUPAC name is 4-methyl-N-(5-methyl-1,2-oxazol-3-yl)-3-(3-methylphenyl)-6-(2-prop-2-ynoxyphenyl)-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxamide.
| Compound Name | 4-methyl-N-(5-methyl-1,2-oxazol-3-yl)-3-(3-methylphenyl)-6-(2-prop-2-ynoxyphenyl)-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 42935272 |
| Molecular Formula | C26H24N4O3S |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | 4-methyl-N-(5-methyl-1,2-oxazol-3-yl)-3-(3-methylphenyl)-6-(2-prop-2-ynoxyphenyl)-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxamide |
| SMILES | C#CCOc1ccccc1C1NC(=S)N(c2cccc(C)c2)C(C)=C1C(=O)Nc1cc(C)on1 |
| InChI | InChI=1S/C26H24N4O3S/c1-5-13-32-21-12-7-6-11-20(21)24-23(25(31)27-22-15-17(3)33-29-22)18(4)30(26(34)28-24)19-10-8-9-16(2)14-19/h1,6-12,14-15,24H,13H2,2-4H3,(H,28,34)(H,27,29,31) |
| InChIKey | VJFMALSJEWKDKI-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 79.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|