C21H23N3OS — CID 46802451
N,N,4-trimethyl-6-(3-methylphenyl)-3-phenyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxamide (PubChem CID 46802451) has the molecular formula C21H23N3OS and a molecular weight of 365.50 g/mol. Its IUPAC name is N,N,4-trimethyl-6-(3-methylphenyl)-3-phenyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxamide.
| Compound Name | N,N,4-trimethyl-6-(3-methylphenyl)-3-phenyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 46802451 |
| Molecular Formula | C21H23N3OS |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | N,N,4-trimethyl-6-(3-methylphenyl)-3-phenyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxamide |
| SMILES | CC1=C(C(=O)N(C)C)C(c2cccc(C)c2)NC(=S)N1c1ccccc1 |
| InChI | InChI=1S/C21H23N3OS/c1-14-9-8-10-16(13-14)19-18(20(25)23(3)4)15(2)24(21(26)22-19)17-11-6-5-7-12-17/h5-13,19H,1-4H3,(H,22,26) |
| InChIKey | PZACUYMVGCGGCF-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|