C17H21N3OS — CID 94441015
(6R)-3-cyclopropyl-N,N,4-trimethyl-6-phenyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxamide (PubChem CID 94441015) has the molecular formula C17H21N3OS and a molecular weight of 315.44 g/mol. Its IUPAC name is (6R)-3-cyclopropyl-N,N,4-trimethyl-6-phenyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxamide.
| Compound Name | (6R)-3-cyclopropyl-N,N,4-trimethyl-6-phenyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 94441015 |
| Molecular Formula | C17H21N3OS |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | (6R)-3-cyclopropyl-N,N,4-trimethyl-6-phenyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxamide |
| SMILES | CC1=C(C(=O)N(C)C)[C@@H](c2ccccc2)NC(=S)N1C1CC1 |
| InChI | InChI=1S/C17H21N3OS/c1-11-14(16(21)19(2)3)15(12-7-5-4-6-8-12)18-17(22)20(11)13-9-10-13/h4-8,13,15H,9-10H2,1-3H3,(H,18,22)/t15-/m1/s1 |
| InChIKey | BRAFDDAMYNUGFO-OAHLLOKOSA-N |
| XLogP | 2.44 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|