C19H19N5O3S2 — CID 25356296
(2S)-2-[1-(2-cyanoethyl)benzimidazol-2-yl]sulfanyl-N-(4-sulfamoylphenyl)propanamide (PubChem CID 25356296) has the molecular formula C19H19N5O3S2 and a molecular weight of 429.53 g/mol. Its IUPAC name is (2S)-2-[1-(2-cyanoethyl)benzimidazol-2-yl]sulfanyl-N-(4-sulfamoylphenyl)propanamide.
| Compound Name | (2S)-2-[1-(2-cyanoethyl)benzimidazol-2-yl]sulfanyl-N-(4-sulfamoylphenyl)propanamide |
|---|---|
| PubChem CID | 25356296 |
| Molecular Formula | C19H19N5O3S2 |
| Molecular Weight | 429.53 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | (2S)-2-[1-(2-cyanoethyl)benzimidazol-2-yl]sulfanyl-N-(4-sulfamoylphenyl)propanamide |
| SMILES | C[C@H](Sc1nc2ccccc2n1CCC#N)C(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C19H19N5O3S2/c1-13(18(25)22-14-7-9-15(10-8-14)29(21,26)27)28-19-23-16-5-2-3-6-17(16)24(19)12-4-11-20/h2-3,5-10,13H,4,12H2,1H3,(H,22,25)(H2,21,26,27)/t13-/m0/s1 |
| InChIKey | ITSJCOUTNUOWEP-ZDUSSCGKSA-N |
| XLogP | 2.72 |
| TPSA | 130.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.53 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |