C25H32N4O4 — CID 25356675
2-[[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]amino]-N-[[(2S)-oxolan-2-yl]methyl]benzamide (PubChem CID 25356675) has the molecular formula C25H32N4O4 and a molecular weight of 452.56 g/mol. Its IUPAC name is 2-[[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]amino]-N-[[(2S)-oxolan-2-yl]methyl]benzamide.
| Compound Name | 2-[[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]amino]-N-[[(2S)-oxolan-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 25356675 |
| Molecular Formula | C25H32N4O4 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | 2-[[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]amino]-N-[[(2S)-oxolan-2-yl]methyl]benzamide |
| SMILES | COc1ccc(N2CCN(C(=O)CNc3ccccc3C(=O)NC[C@@H]3CCCO3)CC2)cc1 |
| InChI | InChI=1S/C25H32N4O4/c1-32-20-10-8-19(9-11-20)28-12-14-29(15-13-28)24(30)18-26-23-7-3-2-6-22(23)25(31)27-17-21-5-4-16-33-21/h2-3,6-11,21,26H,4-5,12-18H2,1H3,(H,27,31)/t21-/m0/s1 |
| InChIKey | AYHNQRUBBGKWSY-NRFANRHFSA-N |
| XLogP | 2.36 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|