C21H32N4O4 — CID 25356834
N-[3-[(2R,6R)-2,6-dimethylmorpholin-4-yl]propyl]-1-(2-nitrophenyl)piperidine-4-carboxamide (PubChem CID 25356834) has the molecular formula C21H32N4O4 and a molecular weight of 404.51 g/mol. Its IUPAC name is N-[3-[(2R,6R)-2,6-dimethylmorpholin-4-yl]propyl]-1-(2-nitrophenyl)piperidine-4-carboxamide.
| Compound Name | N-[3-[(2R,6R)-2,6-dimethylmorpholin-4-yl]propyl]-1-(2-nitrophenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 25356834 |
| Molecular Formula | C21H32N4O4 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | N-[3-[(2R,6R)-2,6-dimethylmorpholin-4-yl]propyl]-1-(2-nitrophenyl)piperidine-4-carboxamide |
| SMILES | C[C@@H]1CN(CCCNC(=O)C2CCN(c3ccccc3[N+](=O)[O-])CC2)C[C@@H](C)O1 |
| InChI | InChI=1S/C21H32N4O4/c1-16-14-23(15-17(2)29-16)11-5-10-22-21(26)18-8-12-24(13-9-18)19-6-3-4-7-20(19)25(27)28/h3-4,6-7,16-18H,5,8-15H2,1-2H3,(H,22,26)/t16-,17-/m1/s1 |
| InChIKey | YFLGQDIYZMCZSF-IAGOWNOFSA-N |
| XLogP | 2.43 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|