C22H20F3N5O4 — CID 25360806
2-[4-(8-nitroisoquinolin-5-yl)piperazin-1-yl]-N-[4-(trifluoromethoxy)phenyl]acetamide (PubChem CID 25360806) has the molecular formula C22H20F3N5O4 and a molecular weight of 475.43 g/mol. Its IUPAC name is 2-[4-(8-nitroisoquinolin-5-yl)piperazin-1-yl]-N-[4-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | 2-[4-(8-nitroisoquinolin-5-yl)piperazin-1-yl]-N-[4-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 25360806 |
| Molecular Formula | C22H20F3N5O4 |
| Molecular Weight | 475.43 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | 2-[4-(8-nitroisoquinolin-5-yl)piperazin-1-yl]-N-[4-(trifluoromethoxy)phenyl]acetamide |
| SMILES | O=C(CN1CCN(c2ccc([N+](=O)[O-])c3cnccc23)CC1)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C22H20F3N5O4/c23-22(24,25)34-16-3-1-15(2-4-16)27-21(31)14-28-9-11-29(12-10-28)19-5-6-20(30(32)33)18-13-26-8-7-17(18)19/h1-8,13H,9-12,14H2,(H,27,31) |
| InChIKey | GXQSLFCSZCCOBQ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 100.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.43 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|