C22H22BrN5O3 — CID 42010146
N-(3-bromo-4-methylphenyl)-2-[4-(8-nitroisoquinolin-5-yl)piperazin-1-yl]acetamide (PubChem CID 42010146) has the molecular formula C22H22BrN5O3 and a molecular weight of 484.35 g/mol. Its IUPAC name is N-(3-bromo-4-methylphenyl)-2-[4-(8-nitroisoquinolin-5-yl)piperazin-1-yl]acetamide.
| Compound Name | N-(3-bromo-4-methylphenyl)-2-[4-(8-nitroisoquinolin-5-yl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 42010146 |
| Molecular Formula | C22H22BrN5O3 |
| Molecular Weight | 484.35 g/mol |
| Exact Mass | 483.09 |
| IUPAC Name | N-(3-bromo-4-methylphenyl)-2-[4-(8-nitroisoquinolin-5-yl)piperazin-1-yl]acetamide |
| SMILES | Cc1ccc(NC(=O)CN2CCN(c3ccc([N+](=O)[O-])c4cnccc34)CC2)cc1Br |
| InChI | InChI=1S/C22H22BrN5O3/c1-15-2-3-16(12-19(15)23)25-22(29)14-26-8-10-27(11-9-26)20-4-5-21(28(30)31)18-13-24-7-6-17(18)20/h2-7,12-13H,8-11,14H2,1H3,(H,25,29) |
| InChIKey | BTRKYHKIDKLMQI-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 91.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.35 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|