C25H29N3O4 — CID 25367233
ethyl 2-[(3S)-4-[[1-methyl-3-(4-phenoxyphenyl)pyrazol-4-yl]methyl]morpholin-3-yl]acetate (PubChem CID 25367233) has the molecular formula C25H29N3O4 and a molecular weight of 435.52 g/mol. Its IUPAC name is ethyl 2-[(3S)-4-[[1-methyl-3-(4-phenoxyphenyl)pyrazol-4-yl]methyl]morpholin-3-yl]acetate.
| Compound Name | ethyl 2-[(3S)-4-[[1-methyl-3-(4-phenoxyphenyl)pyrazol-4-yl]methyl]morpholin-3-yl]acetate |
|---|---|
| PubChem CID | 25367233 |
| Molecular Formula | C25H29N3O4 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | ethyl 2-[(3S)-4-[[1-methyl-3-(4-phenoxyphenyl)pyrazol-4-yl]methyl]morpholin-3-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1COCCN1Cc1cn(C)nc1-c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C25H29N3O4/c1-3-31-24(29)15-21-18-30-14-13-28(21)17-20-16-27(2)26-25(20)19-9-11-23(12-10-19)32-22-7-5-4-6-8-22/h4-12,16,21H,3,13-15,17-18H2,1-2H3/t21-/m0/s1 |
| InChIKey | LJSLJWXOUIVRDP-NRFANRHFSA-N |
| XLogP | 4.03 |
| TPSA | 65.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |