C11H9N7O2S — CID 25369450
4-[3-(3-methyl-5-nitroimidazol-4-yl)sulfanyl-1H-1,2,4-triazol-5-yl]pyridine (PubChem CID 25369450) has the molecular formula C11H9N7O2S and a molecular weight of 303.31 g/mol. Its IUPAC name is 4-[3-(3-methyl-5-nitroimidazol-4-yl)sulfanyl-1H-1,2,4-triazol-5-yl]pyridine.
| Compound Name | 4-[3-(3-methyl-5-nitroimidazol-4-yl)sulfanyl-1H-1,2,4-triazol-5-yl]pyridine |
|---|---|
| PubChem CID | 25369450 |
| Molecular Formula | C11H9N7O2S |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | 4-[3-(3-methyl-5-nitroimidazol-4-yl)sulfanyl-1H-1,2,4-triazol-5-yl]pyridine |
| SMILES | Cn1cnc([N+](=O)[O-])c1Sc1n[nH]c(-c2ccncc2)n1 |
| InChI | InChI=1S/C11H9N7O2S/c1-17-6-13-9(18(19)20)10(17)21-11-14-8(15-16-11)7-2-4-12-5-3-7/h2-6H,1H3,(H,14,15,16) |
| InChIKey | YORZTCJPWCFNLS-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 115.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|