C13H8FN5O2S — CID 4780937
2-[[5-(2-fluorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-3-nitropyridine (PubChem CID 4780937) has the molecular formula C13H8FN5O2S and a molecular weight of 317.31 g/mol. Its IUPAC name is 2-[[5-(2-fluorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-3-nitropyridine.
| Compound Name | 2-[[5-(2-fluorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-3-nitropyridine |
|---|---|
| PubChem CID | 4780937 |
| Molecular Formula | C13H8FN5O2S |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 2-[[5-(2-fluorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-3-nitropyridine |
| SMILES | O=[N+]([O-])c1cccnc1Sc1n[nH]c(-c2ccccc2F)n1 |
| InChI | InChI=1S/C13H8FN5O2S/c14-9-5-2-1-4-8(9)11-16-13(18-17-11)22-12-10(19(20)21)6-3-7-15-12/h1-7H,(H,16,17,18) |
| InChIKey | RRYPZNJEFAOHNG-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 97.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|