C23H38N2OS — CID 25374699
N-[[1-[(2-methoxyphenyl)methyl]piperidin-4-yl]methyl]-N-(2-methylpropyl)thian-4-amine (PubChem CID 25374699) has the molecular formula C23H38N2OS and a molecular weight of 390.64 g/mol. Its IUPAC name is N-[[1-[(2-methoxyphenyl)methyl]piperidin-4-yl]methyl]-N-(2-methylpropyl)thian-4-amine.
| Compound Name | N-[[1-[(2-methoxyphenyl)methyl]piperidin-4-yl]methyl]-N-(2-methylpropyl)thian-4-amine |
|---|---|
| PubChem CID | 25374699 |
| Molecular Formula | C23H38N2OS |
| Molecular Weight | 390.64 g/mol |
| Exact Mass | 390.27 |
| IUPAC Name | N-[[1-[(2-methoxyphenyl)methyl]piperidin-4-yl]methyl]-N-(2-methylpropyl)thian-4-amine |
| SMILES | COc1ccccc1CN1CCC(CN(CC(C)C)C2CCSCC2)CC1 |
| InChI | InChI=1S/C23H38N2OS/c1-19(2)16-25(22-10-14-27-15-11-22)17-20-8-12-24(13-9-20)18-21-6-4-5-7-23(21)26-3/h4-7,19-20,22H,8-18H2,1-3H3 |
| InChIKey | CODABNIDYTXPHY-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.64 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |