C26H35N3O2 — CID 42199295
(E)-N-[[1-[(2-methoxyphenyl)methyl]piperidin-4-yl]methyl]-N-(2-methylpropyl)-3-pyridin-4-ylprop-2-enamide (PubChem CID 42199295) has the molecular formula C26H35N3O2 and a molecular weight of 421.59 g/mol. Its IUPAC name is (E)-N-[[1-[(2-methoxyphenyl)methyl]piperidin-4-yl]methyl]-N-(2-methylpropyl)-3-pyridin-4-ylprop-2-enamide.
| Compound Name | (E)-N-[[1-[(2-methoxyphenyl)methyl]piperidin-4-yl]methyl]-N-(2-methylpropyl)-3-pyridin-4-ylprop-2-enamide |
|---|---|
| PubChem CID | 42199295 |
| Molecular Formula | C26H35N3O2 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.27 |
| IUPAC Name | (E)-N-[[1-[(2-methoxyphenyl)methyl]piperidin-4-yl]methyl]-N-(2-methylpropyl)-3-pyridin-4-ylprop-2-enamide |
| SMILES | COc1ccccc1CN1CCC(CN(CC(C)C)C(=O)/C=C/c2ccncc2)CC1 |
| InChI | InChI=1S/C26H35N3O2/c1-21(2)18-29(26(30)9-8-22-10-14-27-15-11-22)19-23-12-16-28(17-13-23)20-24-6-4-5-7-25(24)31-3/h4-11,14-15,21,23H,12-13,16-20H2,1-3H3/b9-8+ |
| InChIKey | VGWKJEYTGWDHCJ-CMDGGOBGSA-N |
| XLogP | 4.50 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|