C14H14F3N3O2S — CID 2537673
4-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]benzenesulfonamide (PubChem CID 2537673) has the molecular formula C14H14F3N3O2S and a molecular weight of 345.35 g/mol. Its IUPAC name is 4-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]benzenesulfonamide.
| Compound Name | 4-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 2537673 |
| Molecular Formula | C14H14F3N3O2S |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | 4-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(CCNc2ccc(C(F)(F)F)cn2)cc1 |
| InChI | InChI=1S/C14H14F3N3O2S/c15-14(16,17)11-3-6-13(20-9-11)19-8-7-10-1-4-12(5-2-10)23(18,21)22/h1-6,9H,7-8H2,(H,19,20)(H2,18,21,22) |
| InChIKey | CDFXSTWWPBTFMF-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |