C20H30FN3O — CID 25377297
3-(2-fluorophenyl)-N-[(3R)-1-(1-methylpiperidin-4-yl)piperidin-3-yl]propanamide (PubChem CID 25377297) has the molecular formula C20H30FN3O and a molecular weight of 347.48 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-N-[(3R)-1-(1-methylpiperidin-4-yl)piperidin-3-yl]propanamide.
| Compound Name | 3-(2-fluorophenyl)-N-[(3R)-1-(1-methylpiperidin-4-yl)piperidin-3-yl]propanamide |
|---|---|
| PubChem CID | 25377297 |
| Molecular Formula | C20H30FN3O |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.24 |
| IUPAC Name | 3-(2-fluorophenyl)-N-[(3R)-1-(1-methylpiperidin-4-yl)piperidin-3-yl]propanamide |
| SMILES | CN1CCC(N2CCC[C@@H](NC(=O)CCc3ccccc3F)C2)CC1 |
| InChI | InChI=1S/C20H30FN3O/c1-23-13-10-18(11-14-23)24-12-4-6-17(15-24)22-20(25)9-8-16-5-2-3-7-19(16)21/h2-3,5,7,17-18H,4,6,8-15H2,1H3,(H,22,25)/t17-/m1/s1 |
| InChIKey | FDLZXDFVJXWCBU-QGZVFWFLSA-N |
| XLogP | 2.43 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |