C19H26F3N3O — CID 29085480
N-[(3R)-1-(1-methylpiperidin-4-yl)piperidin-3-yl]-2-(2,3,6-trifluorophenyl)acetamide (PubChem CID 29085480) has the molecular formula C19H26F3N3O and a molecular weight of 369.43 g/mol. Its IUPAC name is N-[(3R)-1-(1-methylpiperidin-4-yl)piperidin-3-yl]-2-(2,3,6-trifluorophenyl)acetamide.
| Compound Name | N-[(3R)-1-(1-methylpiperidin-4-yl)piperidin-3-yl]-2-(2,3,6-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 29085480 |
| Molecular Formula | C19H26F3N3O |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.20 |
| IUPAC Name | N-[(3R)-1-(1-methylpiperidin-4-yl)piperidin-3-yl]-2-(2,3,6-trifluorophenyl)acetamide |
| SMILES | CN1CCC(N2CCC[C@@H](NC(=O)Cc3c(F)ccc(F)c3F)C2)CC1 |
| InChI | InChI=1S/C19H26F3N3O/c1-24-9-6-14(7-10-24)25-8-2-3-13(12-25)23-18(26)11-15-16(20)4-5-17(21)19(15)22/h4-5,13-14H,2-3,6-12H2,1H3,(H,23,26)/t13-/m1/s1 |
| InChIKey | JRHIYVGDZKCKAN-CYBMUJFWSA-N |
| XLogP | 2.32 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|