C28H22ClN3O — CID 2537871
N-[3-(3-chloro-4-phenylquinolin-2-yl)-2,5-dimethylpyrrol-1-yl]benzamide (PubChem CID 2537871) has the molecular formula C28H22ClN3O and a molecular weight of 451.96 g/mol. Its IUPAC name is N-[3-(3-chloro-4-phenylquinolin-2-yl)-2,5-dimethylpyrrol-1-yl]benzamide.
| Compound Name | N-[3-(3-chloro-4-phenylquinolin-2-yl)-2,5-dimethylpyrrol-1-yl]benzamide |
|---|---|
| PubChem CID | 2537871 |
| Molecular Formula | C28H22ClN3O |
| Molecular Weight | 451.96 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | N-[3-(3-chloro-4-phenylquinolin-2-yl)-2,5-dimethylpyrrol-1-yl]benzamide |
| SMILES | Cc1cc(-c2nc3ccccc3c(-c3ccccc3)c2Cl)c(C)n1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C28H22ClN3O/c1-18-17-23(19(2)32(18)31-28(33)21-13-7-4-8-14-21)27-26(29)25(20-11-5-3-6-12-20)22-15-9-10-16-24(22)30-27/h3-17H,1-2H3,(H,31,33) |
| InChIKey | QHLRCDXFYPWVNL-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.96 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |