C26H27N3O2S — CID 25385818
(1S,5S,7S)-3-[(2-methoxyphenyl)methyl]-7-(4-phenyl-1,3-thiazol-2-yl)-3,8-diazatricyclo[6.3.0.01,5]undecan-2-one (PubChem CID 25385818) has the molecular formula C26H27N3O2S and a molecular weight of 445.59 g/mol. Its IUPAC name is (1S,5S,7S)-3-[(2-methoxyphenyl)methyl]-7-(4-phenyl-1,3-thiazol-2-yl)-3,8-diazatricyclo[6.3.0.01,5]undecan-2-one.
| Compound Name | (1S,5S,7S)-3-[(2-methoxyphenyl)methyl]-7-(4-phenyl-1,3-thiazol-2-yl)-3,8-diazatricyclo[6.3.0.01,5]undecan-2-one |
|---|---|
| PubChem CID | 25385818 |
| Molecular Formula | C26H27N3O2S |
| Molecular Weight | 445.59 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | (1S,5S,7S)-3-[(2-methoxyphenyl)methyl]-7-(4-phenyl-1,3-thiazol-2-yl)-3,8-diazatricyclo[6.3.0.01,5]undecan-2-one |
| SMILES | COc1ccccc1CN1C[C@@H]2C[C@@H](c3nc(-c4ccccc4)cs3)N3CCC[C@@]23C1=O |
| InChI | InChI=1S/C26H27N3O2S/c1-31-23-11-6-5-10-19(23)15-28-16-20-14-22(29-13-7-12-26(20,29)25(28)30)24-27-21(17-32-24)18-8-3-2-4-9-18/h2-6,8-11,17,20,22H,7,12-16H2,1H3/t20-,22-,26-/m0/s1 |
| InChIKey | CGCBBPVTULMYRE-YBXDKENTSA-N |
| XLogP | 4.76 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.59 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |