C16H19N5O3S — CID 25387222
(2R)-N-(4-cyanophenyl)-2-[[4-(3-methoxypropyl)-5-oxo-1H-1,2,4-triazol-3-yl]sulfanyl]propanamide (PubChem CID 25387222) has the molecular formula C16H19N5O3S and a molecular weight of 361.43 g/mol. Its IUPAC name is (2R)-N-(4-cyanophenyl)-2-[[4-(3-methoxypropyl)-5-oxo-1H-1,2,4-triazol-3-yl]sulfanyl]propanamide.
| Compound Name | (2R)-N-(4-cyanophenyl)-2-[[4-(3-methoxypropyl)-5-oxo-1H-1,2,4-triazol-3-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 25387222 |
| Molecular Formula | C16H19N5O3S |
| Molecular Weight | 361.43 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | (2R)-N-(4-cyanophenyl)-2-[[4-(3-methoxypropyl)-5-oxo-1H-1,2,4-triazol-3-yl]sulfanyl]propanamide |
| SMILES | COCCCn1c(S[C@H](C)C(=O)Nc2ccc(C#N)cc2)n[nH]c1=O |
| InChI | InChI=1S/C16H19N5O3S/c1-11(14(22)18-13-6-4-12(10-17)5-7-13)25-16-20-19-15(23)21(16)8-3-9-24-2/h4-7,11H,3,8-9H2,1-2H3,(H,18,22)(H,19,23)/t11-/m1/s1 |
| InChIKey | AMNVVXJBUMJIEA-LLVKDONJSA-N |
| XLogP | 1.60 |
| TPSA | 112.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.43 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|