C12H18N2O5 — CID 25390316
2-[(2S,3R,4S,5R)-5-(acetamidomethyl)-3,4-dihydroxyoxolan-2-yl]-N-prop-2-ynylacetamide (PubChem CID 25390316) has the molecular formula C12H18N2O5 and a molecular weight of 270.28 g/mol. Its IUPAC name is 2-[(2S,3R,4S,5R)-5-(acetamidomethyl)-3,4-dihydroxyoxolan-2-yl]-N-prop-2-ynylacetamide.
| Compound Name | 2-[(2S,3R,4S,5R)-5-(acetamidomethyl)-3,4-dihydroxyoxolan-2-yl]-N-prop-2-ynylacetamide |
|---|---|
| PubChem CID | 25390316 |
| Molecular Formula | C12H18N2O5 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 2-[(2S,3R,4S,5R)-5-(acetamidomethyl)-3,4-dihydroxyoxolan-2-yl]-N-prop-2-ynylacetamide |
| SMILES | C#CCNC(=O)C[C@@H]1O[C@H](CNC(C)=O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C12H18N2O5/c1-3-4-13-10(16)5-8-11(17)12(18)9(19-8)6-14-7(2)15/h1,8-9,11-12,17-18H,4-6H2,2H3,(H,13,16)(H,14,15)/t8-,9+,11-,12+/m0/s1 |
| InChIKey | DFQYERARJPLKSC-BSJXLVFVSA-N |
| XLogP | -2.25 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|