C20H17N5O2 — CID 25390522
N-[2-(1H-benzimidazol-2-yl)ethyl]-4-cyano-2-methyl-5-pyrrol-1-ylfuran-3-carboxamide (PubChem CID 25390522) has the molecular formula C20H17N5O2 and a molecular weight of 359.39 g/mol. Its IUPAC name is N-[2-(1H-benzimidazol-2-yl)ethyl]-4-cyano-2-methyl-5-pyrrol-1-ylfuran-3-carboxamide.
| Compound Name | N-[2-(1H-benzimidazol-2-yl)ethyl]-4-cyano-2-methyl-5-pyrrol-1-ylfuran-3-carboxamide |
|---|---|
| PubChem CID | 25390522 |
| Molecular Formula | C20H17N5O2 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | N-[2-(1H-benzimidazol-2-yl)ethyl]-4-cyano-2-methyl-5-pyrrol-1-ylfuran-3-carboxamide |
| SMILES | Cc1oc(-n2cccc2)c(C#N)c1C(=O)NCCc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C20H17N5O2/c1-13-18(14(12-21)20(27-13)25-10-4-5-11-25)19(26)22-9-8-17-23-15-6-2-3-7-16(15)24-17/h2-7,10-11H,8-9H2,1H3,(H,22,26)(H,23,24) |
| InChIKey | JVSQXVQGFWIWIT-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 99.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_F(5)', 'substructure': 'N/A'} |
|---|