C23H19N3O2 — CID 25404880
N-[2-(1H-benzimidazol-2-yl)ethyl]-3-methylbenzo[g][1]benzofuran-2-carboxamide (PubChem CID 25404880) has the molecular formula C23H19N3O2 and a molecular weight of 369.42 g/mol. Its IUPAC name is N-[2-(1H-benzimidazol-2-yl)ethyl]-3-methylbenzo[g][1]benzofuran-2-carboxamide.
| Compound Name | N-[2-(1H-benzimidazol-2-yl)ethyl]-3-methylbenzo[g][1]benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 25404880 |
| Molecular Formula | C23H19N3O2 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | N-[2-(1H-benzimidazol-2-yl)ethyl]-3-methylbenzo[g][1]benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)NCCc2nc3ccccc3[nH]2)oc2c1ccc1ccccc12 |
| InChI | InChI=1S/C23H19N3O2/c1-14-16-11-10-15-6-2-3-7-17(15)22(16)28-21(14)23(27)24-13-12-20-25-18-8-4-5-9-19(18)26-20/h2-11H,12-13H2,1H3,(H,24,27)(H,25,26) |
| InChIKey | ISYSHOWBBBZHBP-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |