C24H20N2O2 — CID 27644530
N-[2-(1H-indol-3-yl)ethyl]-3-methylbenzo[g][1]benzofuran-2-carboxamide (PubChem CID 27644530) has the molecular formula C24H20N2O2 and a molecular weight of 368.44 g/mol. Its IUPAC name is N-[2-(1H-indol-3-yl)ethyl]-3-methylbenzo[g][1]benzofuran-2-carboxamide.
| Compound Name | N-[2-(1H-indol-3-yl)ethyl]-3-methylbenzo[g][1]benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 27644530 |
| Molecular Formula | C24H20N2O2 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | N-[2-(1H-indol-3-yl)ethyl]-3-methylbenzo[g][1]benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)NCCc2c[nH]c3ccccc23)oc2c1ccc1ccccc12 |
| InChI | InChI=1S/C24H20N2O2/c1-15-18-11-10-16-6-2-3-8-20(16)23(18)28-22(15)24(27)25-13-12-17-14-26-21-9-5-4-7-19(17)21/h2-11,14,26H,12-13H2,1H3,(H,25,27) |
| InChIKey | YZVDIGSJEJUEQK-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 58.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |