C24H24N2O4 — CID 4837681
N-[2-(1H-indol-3-yl)ethyl]-2-(3,4,8-trimethyl-2-oxochromen-7-yl)oxyacetamide (PubChem CID 4837681) has the molecular formula C24H24N2O4 and a molecular weight of 404.47 g/mol. Its IUPAC name is N-[2-(1H-indol-3-yl)ethyl]-2-(3,4,8-trimethyl-2-oxochromen-7-yl)oxyacetamide.
| Compound Name | N-[2-(1H-indol-3-yl)ethyl]-2-(3,4,8-trimethyl-2-oxochromen-7-yl)oxyacetamide |
|---|---|
| PubChem CID | 4837681 |
| Molecular Formula | C24H24N2O4 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | N-[2-(1H-indol-3-yl)ethyl]-2-(3,4,8-trimethyl-2-oxochromen-7-yl)oxyacetamide |
| SMILES | Cc1c(C)c2ccc(OCC(=O)NCCc3c[nH]c4ccccc34)c(C)c2oc1=O |
| InChI | InChI=1S/C24H24N2O4/c1-14-15(2)24(28)30-23-16(3)21(9-8-18(14)23)29-13-22(27)25-11-10-17-12-26-20-7-5-4-6-19(17)20/h4-9,12,26H,10-11,13H2,1-3H3,(H,25,27) |
| InChIKey | FDYQXCORWIBLAG-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 84.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|