C21H26BrN3O4 — CID 25392821
3-bromo-5-ethoxy-4-methoxy-N'-[2-(2,4,6-trimethylanilino)acetyl]benzohydrazide (PubChem CID 25392821) has the molecular formula C21H26BrN3O4 and a molecular weight of 464.36 g/mol. Its IUPAC name is 3-bromo-5-ethoxy-4-methoxy-N'-[2-(2,4,6-trimethylanilino)acetyl]benzohydrazide.
| Compound Name | 3-bromo-5-ethoxy-4-methoxy-N'-[2-(2,4,6-trimethylanilino)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 25392821 |
| Molecular Formula | C21H26BrN3O4 |
| Molecular Weight | 464.36 g/mol |
| Exact Mass | 463.11 |
| IUPAC Name | 3-bromo-5-ethoxy-4-methoxy-N'-[2-(2,4,6-trimethylanilino)acetyl]benzohydrazide |
| SMILES | CCOc1cc(C(=O)NNC(=O)CNc2c(C)cc(C)cc2C)cc(Br)c1OC |
| InChI | InChI=1S/C21H26BrN3O4/c1-6-29-17-10-15(9-16(22)20(17)28-5)21(27)25-24-18(26)11-23-19-13(3)7-12(2)8-14(19)4/h7-10,23H,6,11H2,1-5H3,(H,24,26)(H,25,27) |
| InChIKey | MGEIHXKYYCRLDT-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.36 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|