C20H21N3O2 — CID 25393557
N-(2-methylphenyl)-2-[(2R)-3-oxo-1-prop-2-enyl-2,4-dihydroquinoxalin-2-yl]acetamide (PubChem CID 25393557) has the molecular formula C20H21N3O2 and a molecular weight of 335.41 g/mol. Its IUPAC name is N-(2-methylphenyl)-2-[(2R)-3-oxo-1-prop-2-enyl-2,4-dihydroquinoxalin-2-yl]acetamide.
| Compound Name | N-(2-methylphenyl)-2-[(2R)-3-oxo-1-prop-2-enyl-2,4-dihydroquinoxalin-2-yl]acetamide |
|---|---|
| PubChem CID | 25393557 |
| Molecular Formula | C20H21N3O2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | N-(2-methylphenyl)-2-[(2R)-3-oxo-1-prop-2-enyl-2,4-dihydroquinoxalin-2-yl]acetamide |
| SMILES | C=CCN1c2ccccc2NC(=O)[C@H]1CC(=O)Nc1ccccc1C |
| InChI | InChI=1S/C20H21N3O2/c1-3-12-23-17-11-7-6-10-16(17)22-20(25)18(23)13-19(24)21-15-9-5-4-8-14(15)2/h3-11,18H,1,12-13H2,2H3,(H,21,24)(H,22,25)/t18-/m1/s1 |
| InChIKey | WKNUJMFTMRHQIR-GOSISDBHSA-N |
| XLogP | 3.34 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|