C24H27NS — CID 25394406
(3S,7R)-3,7-dimethyl-11-(3-methylphenyl)-1,2,3,4,7,8,9,10-octahydro-[1]benzothiolo[2,3-b]quinoline (PubChem CID 25394406) has the molecular formula C24H27NS and a molecular weight of 361.55 g/mol. Its IUPAC name is (3S,7R)-3,7-dimethyl-11-(3-methylphenyl)-1,2,3,4,7,8,9,10-octahydro-[1]benzothiolo[2,3-b]quinoline.
| Compound Name | (3S,7R)-3,7-dimethyl-11-(3-methylphenyl)-1,2,3,4,7,8,9,10-octahydro-[1]benzothiolo[2,3-b]quinoline |
|---|---|
| PubChem CID | 25394406 |
| Molecular Formula | C24H27NS |
| Molecular Weight | 361.55 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | (3S,7R)-3,7-dimethyl-11-(3-methylphenyl)-1,2,3,4,7,8,9,10-octahydro-[1]benzothiolo[2,3-b]quinoline |
| SMILES | Cc1cccc(-c2c3c(nc4sc5c(c24)CC[C@H](C)C5)[C@H](C)CCC3)c1 |
| InChI | InChI=1S/C24H27NS/c1-14-6-4-8-17(12-14)21-19-9-5-7-16(3)23(19)25-24-22(21)18-11-10-15(2)13-20(18)26-24/h4,6,8,12,15-16H,5,7,9-11,13H2,1-3H3/t15-,16+/m0/s1 |
| InChIKey | FPILJRVAZJCQIJ-JKSUJKDBSA-N |
| XLogP | 6.84 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.55 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |