C25H24ClNS — CID 43029631
3,7-dimethyl-2,4-diphenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-b]pyridine;hydrochloride (PubChem CID 43029631) has the molecular formula C25H24ClNS and a molecular weight of 405.99 g/mol. Its IUPAC name is 3,7-dimethyl-2,4-diphenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-b]pyridine;hydrochloride.
| Compound Name | 3,7-dimethyl-2,4-diphenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-b]pyridine;hydrochloride |
|---|---|
| PubChem CID | 43029631 |
| Molecular Formula | C25H24ClNS |
| Molecular Weight | 405.99 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | 3,7-dimethyl-2,4-diphenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-b]pyridine;hydrochloride |
| SMILES | Cc1c(-c2ccccc2)nc2sc3c(c2c1-c1ccccc1)CCC(C)C3.Cl |
| InChI | InChI=1S/C25H23NS.ClH/c1-16-13-14-20-21(15-16)27-25-23(20)22(18-9-5-3-6-10-18)17(2)24(26-25)19-11-7-4-8-12-19;/h3-12,16H,13-15H2,1-2H3;1H |
| InChIKey | IDIGZEPRNKHKSY-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.99 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |