C17H28N4O4 — CID 25397724
N-tert-butyl-2-[[2-[(5S,6S)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetyl]amino]acetamide (PubChem CID 25397724) has the molecular formula C17H28N4O4 and a molecular weight of 352.44 g/mol. Its IUPAC name is N-tert-butyl-2-[[2-[(5S,6S)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetyl]amino]acetamide.
| Compound Name | N-tert-butyl-2-[[2-[(5S,6S)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetyl]amino]acetamide |
|---|---|
| PubChem CID | 25397724 |
| Molecular Formula | C17H28N4O4 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.21 |
| IUPAC Name | N-tert-butyl-2-[[2-[(5S,6S)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetyl]amino]acetamide |
| SMILES | C[C@H]1CCCC[C@]12NC(=O)N(CC(=O)NCC(=O)NC(C)(C)C)C2=O |
| InChI | InChI=1S/C17H28N4O4/c1-11-7-5-6-8-17(11)14(24)21(15(25)20-17)10-13(23)18-9-12(22)19-16(2,3)4/h11H,5-10H2,1-4H3,(H,18,23)(H,19,22)(H,20,25)/t11-,17-/m0/s1 |
| InChIKey | APJPBHFLAZDYOA-GTNSWQLSSA-N |
| XLogP | 0.52 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|